ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
| product Name |
3-(trifluoromethyl)phenoxyacetonitrile |
| CAS No |
2145-31-5 |
| Synonyms |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
| Molecular Formula |
C8H7FO3 |
| Molecular Weight |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
| Molecular Structure |
|
| Density |
1.309g/cm3 |
| Boiling point |
268.9°C at 760 mmHg |
| Refractive index |
1.526 |
| Flash point |
116.4°C |
| Vapour Pressur |
0.00452mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
